CAS 88358-26-3
:2-Bromo-N-(2-methylpropyl)benzamide
Description:
2-Bromo-N-(2-methylpropyl)benzamide is an organic compound characterized by its structure, which includes a benzamide moiety substituted with a bromine atom and a 2-methylpropyl group. This compound features a benzene ring attached to a carbonyl group (amide) and exhibits typical amide properties, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the bromine atom introduces halogen characteristics, potentially enhancing its reactivity in nucleophilic substitution reactions. The 2-methylpropyl substituent contributes to the compound's hydrophobic nature, affecting its solubility in polar solvents. In terms of physical properties, compounds like this often exhibit moderate melting and boiling points, influenced by molecular weight and intermolecular interactions. Additionally, 2-Bromo-N-(2-methylpropyl)benzamide may have applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with biological targets. Safety and handling precautions should be observed, as with all brominated compounds, due to potential toxicity and environmental concerns.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c1-8(2)7-13-11(14)9-5-3-4-6-10(9)12/h3-6,8H,7H2,1-2H3,(H,13,14)
InChI key:InChIKey=UNFJEINMGBRHJZ-UHFFFAOYSA-N
SMILES:C(NCC(C)C)(=O)C1=C(Br)C=CC=C1
Synonyms:- 2-Bromo-N-(2-methylpropyl)benzamide
- 2-Bromo-N-isobutyl-benzamide
- 2-Bromo-N-isobutylbenzamide
- N-Isobutyl 2-bromobenzamide
- Benzamide, 2-bromo-N-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
