CAS 88368-75-6
:3-hydroxy-3,3-diphenylpropanehydrazide
Description:
3-Hydroxy-3,3-diphenylpropanehydrazide, identified by its CAS number 88368-75-6, is an organic compound characterized by the presence of a hydrazide functional group attached to a propane backbone that is further substituted with two phenyl groups and a hydroxyl group. This compound typically exhibits properties associated with hydrazides, such as potential reactivity in condensation reactions and the ability to form derivatives through acylation or alkylation. The presence of the hydroxyl group suggests it may also engage in hydrogen bonding, influencing its solubility and reactivity. The diphenyl substitution can enhance its stability and may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound's structure may allow for specific interactions with biological targets, which could be explored in medicinal chemistry. Overall, 3-hydroxy-3,3-diphenylpropanehydrazide represents a versatile compound with potential utility in both synthetic and applied chemistry contexts.
Formula:C15H16N2O2
InChI:InChI=1/C15H16N2O2/c16-17-14(18)11-15(19,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,19H,11,16H2,(H,17,18)
SMILES:c1ccc(cc1)C(CC(=NN)O)(c1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
