CymitQuimica logo

CAS 88370-06-3

:

1,3,4-Thiadiazole, 2-bromo-5-(1,1-dimethylethyl)-

Description:
1,3,4-Thiadiazole, 2-bromo-5-(1,1-dimethylethyl)- is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. The compound features a bromine substituent at the 2-position and a tert-butyl group at the 5-position of the thiadiazole ring, contributing to its unique chemical properties. This structure imparts specific reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the bromine atom can enhance the compound's reactivity in nucleophilic substitution reactions, while the bulky tert-butyl group can influence its steric properties and solubility. Additionally, the compound may exhibit biological activity, which is often explored in medicinal chemistry. As with many heterocycles, the electronic properties of the thiadiazole ring can also play a significant role in its interactions with other molecules, making it a subject of interest in material science and organic synthesis.
Formula:C6H9BrN2S
InChI:InChI=1S/C6H9BrN2S/c1-6(2,3)4-8-9-5(7)10-4/h1-3H3
InChI key:NTCALTKEJCVOMO-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=NN=C(S1)Br
Found 1 products.