CAS 88371-31-7
:Methyl 3-[(3-ethoxy-1-oxo-2-propen-1-yl)amino]benzoate
Description:
Methyl 3-[(3-ethoxy-1-oxo-2-propen-1-yl)amino]benzoate, identified by its CAS number 88371-31-7, is an organic compound characterized by its ester functional group and an amine linkage. This compound features a methyl ester derived from benzoic acid, which contributes to its aromatic properties. The presence of the ethoxy group and the propenyl moiety indicates that it has potential reactivity, particularly in nucleophilic substitution or addition reactions. The structure suggests that it may exhibit biological activity, possibly as a pharmaceutical intermediate or in agrochemical applications. Its solubility characteristics are likely influenced by the ester and ether functionalities, making it soluble in organic solvents while having limited solubility in water. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, Methyl 3-[(3-ethoxy-1-oxo-2-propen-1-yl)amino]benzoate represents a versatile chemical structure with potential applications in various fields, including medicinal chemistry and material science.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c1-3-18-8-7-12(15)14-11-6-4-5-10(9-11)13(16)17-2/h4-9H,3H2,1-2H3,(H,14,15)
InChI key:InChIKey=IXLZDUYBUURIQH-UHFFFAOYSA-N
SMILES:N(C(C=COCC)=O)C1=CC(C(OC)=O)=CC=C1
Synonyms:- Methyl 3-[(3-ethoxy-1-oxo-2-propen-1-yl)amino]benzoate
- Benzoic acid, 3-[(3-ethoxy-1-oxo-2-propenyl)amino]-, methyl ester
- Benzoic acid, 3-[(3-ethoxy-1-oxo-2-propen-1-yl)amino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, 3-[(3-ethoxy-1-oxo-2-propenyl)amino]-, methyl ester
CAS:Formula:C13H15NO4Molecular weight:249.2625
