
CAS 883727-41-1
:N1,N1-Dimethyl-N3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzenediamine
Description:
N1,N1-Dimethyl-N3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzenediamine is a complex organic compound characterized by its multi-functional structure, which includes both amine and boron-containing moieties. The presence of dimethyl and phenyl groups contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The dioxaborolane unit is notable for its ability to participate in various chemical reactions, including cross-coupling reactions, making this compound of interest in materials science and organic electronics. Its molecular structure suggests potential solubility in organic solvents, and it may exhibit unique optical or electronic properties due to the conjugated aromatic systems. Safety and handling considerations are essential, as with many organic compounds, particularly those containing boron, which can have specific reactivity profiles. Overall, this compound's unique features make it a candidate for research in fields such as organic synthesis, medicinal chemistry, and materials development.
Formula:C20H27BN2O2
InChI:InChI=1S/C20H27BN2O2/c1-19(2)20(3,4)25-21(24-19)15-12-17(14-18(13-15)23(5)6)22-16-10-8-7-9-11-16/h7-14,22H,1-6H3
InChI key:InChIKey=SCNOGYPUWQHQES-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(N(C)C)=CC(NC3=CC=CC=C3)=C2
Synonyms:- 1,3-Benzenediamine, N1,N1-dimethyl-N3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1,3-Benzenediamine, N,N-dimethyl-N′-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N1,N1-Dimethyl-N3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N1,N1-DIMETHYL-N3-PHENYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZENE-1,3-DIAMINE
CAS:Formula:C20H27BN2O2Molecular weight:338.2516
