CAS 88373-30-2

6-[(4-ethenylbenzyl)(propyl)amino]-1,3,5-triazine-2,4(1H,3H)-dithione

Description:

6-[(4-Ethenylbenzyl)(propyl)amino]-1,3,5-triazine-2,4(1H,3H)-dithione is a chemical compound characterized by its unique structure, which includes a triazine ring and a dithione functional group. The presence of the ethenylbenzyl and propyl groups contributes to its potential as a versatile building block in organic synthesis. This compound may exhibit interesting biological activities due to its nitrogen-rich triazine core, which is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The dithione moiety can also impart specific reactivity, making it useful in applications such as agrochemicals or pharmaceuticals. Additionally, the compound's solubility and stability in different solvents can vary, influencing its practical applications. Overall, the structural features of this compound suggest potential utility in diverse fields, including materials science and medicinal chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₅H₁₈N₄S₂

InChI: InChI=1/C15H18N4S2/c1-3-9-19(13-16-14(20)18-15(21)17-13)10-12-7-5-11(4-2)6-8-12/h4-8H,2-3,9-10H2,1H3,(H2,16,17,18,20,21)

SMILES: CCCN(Cc1ccc(C=C)cc1)c1nc(nc(n1)S)S

Synonyms:

• 6-[4-Ethenylphenyl-(N-Propyl)]Amino-1,3,5-Triazine-2,4-Dithione