CAS 883738-20-3

4-[(3-Bromophenyl)methyl]-2-piperazinone

Description:

4-[(3-Bromophenyl)methyl]-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring substituted with a bromophenyl group. This compound typically exhibits properties associated with both the piperazine moiety and the aromatic bromine substitution, such as potential biological activity and solubility in organic solvents. The presence of the bromine atom can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The piperazinone structure may contribute to its pharmacological properties, including potential use as an antidepressant or antipsychotic agent. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for its application in research and development. Safety data and handling precautions should be considered, as with any chemical substance, particularly due to the presence of the bromine atom, which can pose environmental and health risks. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research.

Formula: C₁₁H₁₃BrN₂O

InChI: InChI=1S/C11H13BrN2O/c12-10-3-1-2-9(6-10)7-14-5-4-13-11(15)8-14/h1-3,6H,4-5,7-8H2,(H,13,15)

InChI key: InChIKey=KZMARMPICJTYNJ-UHFFFAOYSA-N

SMILES: C(C1=CC(Br)=CC=C1)N2CC(=O)NCC2

Synonyms:

• 4-[(3-Bromophenyl)methyl]-2-piperazinone
• Piperazinone, 4-[(3-bromophenyl)methyl]-
• 2-Piperazinone, 4-[(3-bromophenyl)methyl]-