CymitQuimica logo

CAS 883738-28-1

:

N-[[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanecarboxamide

Description:
N-[[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanecarboxamide, identified by its CAS number 883738-28-1, is a chemical compound characterized by its complex structure that includes a cyclopentanecarboxamide moiety and a boron-containing dioxaborolane group. This compound typically exhibits properties associated with both organic amides and boron-containing compounds, such as potential solubility in organic solvents and the ability to participate in various chemical reactions, including those involving boron reactivity. The presence of the tetramethyl dioxaborolane group suggests that it may have applications in organic synthesis, particularly in the formation of carbon-boron bonds. Additionally, the phenyl and cyclopentane components may influence its steric and electronic properties, potentially affecting its reactivity and interactions in biological systems. Overall, this compound's unique structure positions it as a candidate for further research in fields such as medicinal chemistry and materials science.
Formula:C19H28BNO3
InChI:InChI=1S/C19H28BNO3/c1-18(2)19(3,4)24-20(23-18)16-11-7-8-14(12-16)13-21-17(22)15-9-5-6-10-15/h7-8,11-12,15H,5-6,9-10,13H2,1-4H3,(H,21,22)
InChI key:InChIKey=ZURXZIIYGGVLKV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(CNC(=O)C3CCCC3)=CC=C2
Synonyms:
  • Cyclopentanecarboxamide, N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-
  • N-[[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopentanecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.