CAS 883738-38-3
:3-(4-Methyl-1-piperazinylcarbonyl)benzeneboronic acid pinacol ester
Description:
3-(4-Methyl-1-piperazinylcarbonyl)benzeneboronic acid pinacol ester, identified by its CAS number 883738-38-3, is a chemical compound that features a boronic acid moiety, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound contains a piperazine ring, which contributes to its biological activity and solubility properties. The presence of the pinacol ester group enhances its stability and reactivity, making it suitable for various coupling reactions, particularly in the synthesis of complex organic molecules. The methyl group on the piperazine ring may influence its lipophilicity and interaction with biological targets. Overall, this compound is characterized by its potential applications in drug development and as a building block in organic synthesis, particularly in the formation of carbon-carbon bonds through Suzuki coupling reactions. Its specific physical and chemical properties, such as solubility, melting point, and reactivity, would need to be determined through experimental methods.
Formula:C18H27BN2O3
InChI:InChI=1/C18H27BN2O3/c1-17(2)18(3,4)24-19(23-17)15-8-6-7-14(13-15)16(22)21-11-9-20(5)10-12-21/h6-8,13H,9-12H2,1-5H3
SMILES:CC1(C)C(C)(C)OB(c2cccc(c2)C(=O)N2CCN(C)CC2)O1
Synonyms:- (4-Methylpiperazin-1-yl)[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone
- Methanone, (4-methyl-1-piperazinyl)[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
- 1-Methyl-4-{[3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl]Carbonyl}Piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(4-Methyl-1-piperazinylcarbonyl)benzeneboronic acid pinacol ester, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C18H27BN2O3Purity:97%Color and Shape:White to pale cream, PowderMolecular weight:330.24(4-Methylpiperazin-1-yl)(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone
CAS:Formula:C18H27BN2O3Purity:98%Color and Shape:SolidMolecular weight:330.2296[3-(4-Methylpiperazine-1-carbonyl)phenyl]boronic acid pinacol ester
CAS:<p>[3-(4-Methylpiperazine-1-carbonyl)phenyl]boronic acid pinacol ester</p>Purity:98%Molecular weight:330.23g/molN-(4-Methyl-piperazine)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)benzamide
CAS:Formula:C18H27BN2O3Purity:97.0%Color and Shape:SolidMolecular weight:330.24N-(4-Methyl-piperazine)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)benzamide
CAS:<p>Versatile small molecule scaffold</p>Formula:C18H27BN2O3Purity:Min. 95%Molecular weight:330.24 g/mol




