CAS 88374-14-5
:3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)prop-2-en-1-one
Description:
3-(2,6-Dichlorophenyl)-1-(4-nitrophenyl)prop-2-en-1-one, with the CAS number 88374-14-5, is an organic compound characterized by its conjugated system, which includes a prop-2-en-1-one backbone. This compound features two distinct aromatic substituents: a 2,6-dichlorophenyl group and a 4-nitrophenyl group, contributing to its unique electronic properties and potential reactivity. The presence of the electron-withdrawing nitro group and the halogen substituents can influence the compound's polarity, solubility, and overall stability. Typically, compounds of this nature exhibit significant UV-Vis absorbance due to their conjugated double bonds, making them of interest in various applications, including organic synthesis and materials science. Additionally, the dichlorophenyl and nitrophenyl groups may impart biological activity, warranting further investigation into their potential pharmacological properties. Overall, this compound exemplifies the complexity and versatility of substituted chalcones in organic chemistry.
Formula:C15H9Cl2NO3
InChI:InChI=1/C15H9Cl2NO3/c16-13-2-1-3-14(17)12(13)8-9-15(19)10-4-6-11(7-5-10)18(20)21/h1-9H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propen-1-one,3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)-
CAS:Formula:C15H9Cl2NO3Molecular weight:322.1429
