CAS 88374-36-1
:1-(5-Nitro-2-pyridinyl)-3-piperidinol
Description:
1-(5-Nitro-2-pyridinyl)-3-piperidinol, with the CAS number 88374-36-1, is a chemical compound characterized by its unique structural features, which include a piperidinol moiety and a nitro-substituted pyridine ring. This compound typically exhibits properties associated with both the piperidine and pyridine functional groups, such as basicity and potential for hydrogen bonding due to the hydroxyl group. The presence of the nitro group can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the compound may display biological activity, which is often explored in medicinal chemistry for potential therapeutic applications. Its solubility, stability, and interaction with biological systems can vary based on environmental conditions and the presence of other chemical entities. Overall, 1-(5-Nitro-2-pyridinyl)-3-piperidinol represents a versatile structure in organic synthesis and pharmacology, warranting further investigation into its properties and applications.
Formula:C10H13N3O3
InChI:InChI=1/C10H13N3O3/c14-9-2-1-5-12(7-9)10-4-3-8(6-11-10)13(15)16/h3-4,6,9,14H,1-2,5,7H2
SMILES:C1CC(CN(C1)c1ccc(cn1)N(=O)=O)O
Synonyms:- 1-(5-Nitropyridin-2-yl)piperidin-3-ol
- 3-Piperidinol, 1-(5-Nitro-2-Pyridinyl)-
- 1-(5-Nitro-2-Pyridyl)Piperidin-3-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.