CAS 88377-29-1
:2-bromo-3-methoxybenzoic acid
Description:
2-Bromo-3-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methoxy group on a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid (-COOH) functional group, which contributes to its acidic properties. The bromine substituent at the second position and the methoxy group (-OCH3) at the third position influence its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to the hydrophobic nature of the aromatic ring and the methoxy group. It may exhibit moderate to strong acidity, making it useful in various chemical reactions, including esterification and nucleophilic substitution. Additionally, 2-bromo-3-methoxybenzoic acid can serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals, highlighting its importance in organic synthesis and medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7BrO3
InChI:InChI=1/C8H7BrO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11)
SMILES:COc1cccc(c1Br)C(=O)O
Synonyms:- Benzoic Acid, 2-Bromo-3-Methoxy-
- 2-Bromo-3-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzoic acid, 2-bromo-3-methoxy-
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.04342-Bromo-3-methoxybenzoic acid
CAS:2-Bromo-3-methoxybenzoic acidFormula:C8H7BrO3Purity:≥95%Color and Shape: faint brown crystalline solidMolecular weight:231.04g/mol2-Bromo-3-methoxybenzoic acid
CAS:Formula:C8H7BrO3Purity:97%Color and Shape:SolidMolecular weight:231.0452-Bromo-3-methoxybenzoic Acid
CAS:Controlled ProductApplications 2-Bromo-3-methoxybenzoic acid (cas# 88377-29-1) is a useful research chemical.
Formula:C8H7O3BrColor and Shape:NeatMolecular weight:231.042-Bromo-3-methoxybenzoic acid
CAS:2-Bromo-3-methoxybenzoic acid is a fluorescent acridine that can be used as a reagent, an analogue of acridone, and a ligand for macrocycles. It can also be used to synthesize fluorophores that are glycols. 2-Bromo-3-methoxybenzoic acid is cyclised to form the acridine ring system with two methoxy groups on the 2 and 3 positions. The bromine atom on the 2 position is replaced by a hydrogen atom in the final product.
Formula:C8H7BrO3Purity:Min. 95%Molecular weight:231.04 g/mol





