CymitQuimica logo

CAS 88378-50-1

:

(2R)-3-bromo-1,1,1-trifluoropropan-2-ol

Description:
(2R)-3-bromo-1,1,1-trifluoropropan-2-ol, with the CAS number 88378-50-1, is a halogenated organic compound characterized by the presence of a bromine atom and three fluorine atoms attached to a propanol backbone. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the (2R) configuration. The trifluoromethyl group enhances its reactivity and polarity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both bromine and fluorine atoms can impart unique properties, such as increased lipophilicity and potential bioactivity. Additionally, the compound is likely to exhibit significant hydrogen bonding capabilities due to the hydroxyl (-OH) group, influencing its solubility and interaction with other molecules. Safety considerations should be taken into account when handling this substance, as halogenated compounds can pose environmental and health risks. Overall, (2R)-3-bromo-1,1,1-trifluoropropan-2-ol is a notable compound in the field of synthetic organic chemistry.
Formula:C3H4BrF3O
InChI:InChI=1/C3H4BrF3O/c4-1-2(8)3(5,6)7/h2,8H,1H2/t2-/m0/s1
SMILES:C([C@@H](C(F)(F)F)O)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.