CymitQuimica logo

CAS 88381-44-6

:

3-nitroso-1,3-thiazolidine-4-carboxylic acid

Description:
3-Nitroso-1,3-thiazolidine-4-carboxylic acid is a heterocyclic compound characterized by the presence of a thiazolidine ring, which incorporates both sulfur and nitrogen atoms. This compound features a nitroso group (-NO) and a carboxylic acid group (-COOH), contributing to its reactivity and potential biological activity. The thiazolidine structure provides a five-membered ring that can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The nitroso group can act as a signaling molecule and may play a role in biological processes, while the carboxylic acid group can influence solubility and acidity. This compound may be of interest in medicinal chemistry and organic synthesis due to its unique structural features and potential applications in drug development or as a biochemical probe. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. As with many chemical substances, safety precautions should be taken when handling it, given the potential reactivity of the nitroso group.
Formula:C4H6N2O3S
InChI:InChI=1/C4H6N2O3S/c7-4(8)3-1-10-2-6(3)5-9/h3H,1-2H2,(H,7,8)
SMILES:C1C(C(=O)O)N(CS1)N=O
Synonyms:
  • 4-Thiazolidinecarboxylic Acid, 3-Nitroso-
  • 3-Nitroso-1,3-thiazolidine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.