CAS 88382-46-1

4-[(4-methylphenoxy)methyl]benzoic acid

Description:

4-[(4-Methylphenoxy)methyl]benzoic acid, with the CAS number 88382-46-1, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, contributing to its acidity and potential for hydrogen bonding. The compound also contains a 4-methylphenoxy group, indicating the presence of a methyl substituent on the phenyl ring, which can influence its solubility and reactivity. This substance is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its chemical properties suggest potential applications in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate or a building block for more complex molecules. Additionally, the presence of both hydrophobic and hydrophilic regions in its structure may allow for interesting interactions in biological systems or polymer matrices. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₅H₁₄O₃

InChI: InChI=1/C15H14O3/c1-11-2-8-14(9-3-11)18-10-12-4-6-13(7-5-12)15(16)17/h2-9H,10H2,1H3,(H,16,17)

SMILES: Cc1ccc(cc1)OCc1ccc(cc1)C(=O)O

Synonyms:

• Benzoic Acid, 4-[(4-Methylphenoxy)Methyl]-

4-[(4-methylphenoxy)methyl]benzoic acid

CAS: 88382-46-1

Formula: C₁₅H₁₄O₃

Purity: 95.0%

Molecular weight: 242.274

Ref: 10-F309960