CAS 88382-47-2

4-[(3,4-Dimethylphenoxy)methyl]benzoic acid

Description:

4-[(3,4-Dimethylphenoxy)methyl]benzoic acid, with the CAS number 88382-47-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, contributing to its acidic properties. The presence of a 3,4-dimethylphenoxy group indicates that the compound has a phenolic ether linkage, enhancing its hydrophobic characteristics and potentially influencing its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the presence of methyl groups on the aromatic ring can affect its steric and electronic properties, influencing its reactivity and interactions with other molecules. Overall, 4-[(3,4-Dimethylphenoxy)methyl]benzoic acid is a versatile compound with potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₆H₁₆O₃

InChI: InChI=1S/C16H16O3/c1-11-3-8-15(9-12(11)2)19-10-13-4-6-14(7-5-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18)

InChI key: InChIKey=JZRVWERFZKKVPQ-UHFFFAOYSA-N

SMILES: C(OC1=CC(C)=C(C)C=C1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[(3,4-Dimethylphenoxy)methyl]benzoic acid
• Benzoic acid, 4-[(3,4-dimethylphenoxy)methyl]-

4-[(3,4-Dimethylphenoxy)methyl]benzoic acid

CAS: 88382-47-2

Versatile small molecule scaffold

Formula: C₁₆H₁₆O₃

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-NDA38247