CymitQuimica logo

CAS 88382-49-4

:

4-[(phenylsulfanyl)methyl]benzoic acid

Description:
4-[(Phenylsulfanyl)methyl]benzoic acid, with the CAS number 88382-49-4, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a phenylsulfanyl group. This compound features a sulfur atom bonded to a phenyl group, which is further connected to a methyl group that links to the benzoic acid structure. The presence of the phenylsulfanyl group can impart unique chemical properties, such as increased lipophilicity and potential for specific interactions in biological systems. The carboxylic acid functional group in the benzoic acid portion contributes to its acidity and reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit interesting physical properties, such as solubility in organic solvents and varying melting points, depending on the purity and crystalline form. Overall, 4-[(phenylsulfanyl)methyl]benzoic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H12O2S
InChI:InChI=1/C14H12O2S/c15-14(16)12-8-6-11(7-9-12)10-17-13-4-2-1-3-5-13/h1-9H,10H2,(H,15,16)
SMILES:c1ccc(cc1)SCc1ccc(cc1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.