CAS 883874-84-8

2-chloro-4-(4-fluorophenyl)pyridine

Description:

2-Chloro-4-(4-fluorophenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chlorine atom at the 2-position and a para-fluorophenyl group at the 4-position of the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of both chlorine and fluorine substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₁₁H₇ClFN

InChI: InChI=1/C11H7ClFN/c12-11-7-9(5-6-14-11)8-1-3-10(13)4-2-8/h1-7H

SMILES: c1cc(ccc1c1ccnc(c1)Cl)F

Synonyms:

• Pyridine, 2-Chloro-4-(4-Fluorophenyl)-