CAS 883898-17-7
:ethyl 5-(3-oxocyclohexyl)furan-2-carboxylate
Description:
Ethyl 5-(3-oxocyclohexyl)furan-2-carboxylate is an organic compound characterized by its furan and cyclohexyl moieties, which contribute to its unique chemical properties. The presence of the furan ring indicates potential reactivity due to its electron-rich nature, making it a candidate for various chemical transformations, such as electrophilic substitutions or cycloadditions. The cyclohexyl group, particularly with a ketone functionality, can influence the compound's steric and electronic properties, potentially enhancing its reactivity in organic synthesis. As an ester, it exhibits typical ester characteristics, such as being relatively non-polar and having moderate solubility in organic solvents. The compound may also display interesting biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. However, specific physical properties such as boiling point, melting point, and solubility would require experimental determination or literature reference for precise values. Overall, ethyl 5-(3-oxocyclohexyl)furan-2-carboxylate presents a versatile framework for further chemical exploration.
Formula:C13H16O4
InChI:InChI=1/C13H16O4/c1-2-16-13(15)12-7-6-11(17-12)9-4-3-5-10(14)8-9/h6-7,9H,2-5,8H2,1H3
SMILES:CCOC(=O)c1ccc(C2CCCC(=O)C2)o1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.