CymitQuimica logo

CAS 883898-97-3

:

Benzonitrile,2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-methoxy-

Description:
Benzonitrile, 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-methoxy- is an organic compound characterized by the presence of a benzonitrile moiety, which features a cyano group (-C≡N) attached to a benzene ring. The compound also contains a dioxaborinane structure, which includes a boron atom bonded to two oxygen atoms in a cyclic arrangement, contributing to its unique reactivity and potential applications in organic synthesis. The methoxy group (-OCH₃) at the 3-position of the benzene ring enhances its solubility in organic solvents and may influence its electronic properties. This compound may exhibit interesting chemical behavior due to the presence of both the electron-withdrawing cyano group and the electron-donating methoxy group, potentially making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its specific applications and reactivity would depend on the context of its use in synthetic chemistry or materials science. As with many boron-containing compounds, it may also have implications in medicinal chemistry and catalysis.
Formula:C13H16BNO3
InChI:InChI=1S/C13H16BNO3/c1-13(2)8-17-14(18-9-13)12-10(7-15)5-4-6-11(12)16-3/h4-6H,8-9H2,1-3H3
InChI key:KQEYALGDGSYUCE-UHFFFAOYSA-N
SMILES:B1(OCC(CO1)(C)C)C2=C(C=CC=C2OC)C#N
Synonyms:
  • 2-Cyano-6-Methoxyphenyl Boronic Acid Neopentyl Glycol Ester
  • 2-Cyano-6-Methoxyphenylboronic Acid Neopentyl Glycol
Found 5 products.