CAS 88390-30-1
:Butanoic acid, 2-methyl-4-nitro-, methyl ester, (S)-
Description:
Butanoic acid, 2-methyl-4-nitro-, methyl ester, (S)-, is an organic compound characterized by its ester functional group, which is derived from butanoic acid. This compound features a butanoic acid backbone with a methyl group at the second carbon and a nitro group at the fourth carbon, contributing to its unique chemical properties. The (S)- designation indicates that it has a specific stereochemistry, making it a chiral molecule. Typically, such compounds exhibit moderate solubility in polar solvents due to the presence of the ester group, while the nitro group can influence reactivity and polarity. The presence of both the methyl and nitro substituents can affect the compound's boiling point, melting point, and overall stability. In terms of applications, esters like this one are often utilized in organic synthesis, flavoring, and fragrance industries, as well as in pharmaceuticals. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and may pose health risks.
Formula:C6H11NO4
InChI:InChI=1S/C6H11NO4/c1-5(6(8)11-2)3-4-7(9)10/h5H,3-4H2,1-2H3/t5-/m0/s1
InChI key:InChIKey=NFPZWOOLCCQVDX-YFKPBYRVSA-N
SMILES:[C@H](CCN(=O)=O)(C(OC)=O)C
Synonyms:- Butanoic acid, 2-methyl-4-nitro-, methyl ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
