CymitQuimica logo

CAS 88393-56-0

:

N,N'-dibenzyl-L-tartramide

Description:
N,N'-dibenzyl-L-tartramide is a chemical compound characterized by its structure, which includes two benzyl groups attached to the nitrogen atoms of the tartramide backbone. This compound is derived from L-tartaric acid, a naturally occurring organic acid, and features amide functional groups that contribute to its chemical properties. N,N'-dibenzyl-L-tartramide is typically a white to off-white solid and is soluble in organic solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of the benzyl groups enhances its lipophilicity, which can influence its biological activity and interaction with other molecules. Additionally, the compound may exhibit chiral properties due to the presence of the L-tartaric acid moiety, which can be significant in enantioselective reactions. Overall, N,N'-dibenzyl-L-tartramide is an interesting compound with potential applications in medicinal chemistry and materials science, owing to its unique structural features and functional groups.
Formula:C18H20N2O4
InChI:InChI=1/C18H20N2O4/c21-15(17(23)19-11-13-7-3-1-4-8-13)16(22)18(24)20-12-14-9-5-2-6-10-14/h1-10,15-16,21-22H,11-12H2,(H,19,23)(H,20,24)/t15-,16-/m1/s1
SMILES:c1ccc(cc1)CN=C([C@@H]([C@H](C(=NCc1ccccc1)O)O)O)O
Synonyms:
  • (+)-N,N-Dibenzyl-L-tartaric diamide
  • (2R,3R)-N,N'-dibenzyl-2,3-dihydroxybutanediamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.