CAS 883948-67-2
:3-(2-Benzylamino-ethyl)-1H-quinazoline-2,4-dione
Description:
3-(2-Benzylamino-ethyl)-1H-quinazoline-2,4-dione, identified by its CAS number 883948-67-2, is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a fused benzene and pyrimidine ring. This compound features a benzylamino group at the 3-position and an ethyl chain, contributing to its potential biological activity. Quinazoline derivatives are known for their diverse pharmacological properties, including anticancer, anti-inflammatory, and antimicrobial activities. The presence of the benzylamino moiety may enhance its ability to interact with biological targets, potentially influencing its solubility and bioavailability. The compound's structure suggests it may participate in hydrogen bonding and π-π stacking interactions, which are crucial for its biological efficacy. Additionally, the presence of two carbonyl groups in the 2 and 4 positions of the quinazoline ring may contribute to its reactivity and stability. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry for their potential therapeutic applications.
Formula:C17H17N3O2
InChI:InChI=1S/C17H17N3O2/c21-16-14-8-4-5-9-15(14)19-17(22)20(16)11-10-18-12-13-6-2-1-3-7-13/h1-9,18H,10-12H2,(H,19,22)
SMILES:c1ccc(cc1)CNCCn1c(=O)c2ccccc2nc1O
Synonyms:- 3-[2-(benzylamino)ethyl]quinazoline-2,4(1H,3H)-dione
- 3-[2-[(Phenylmethyl)amino]ethyl]-2,4(1H,3H)quinazolinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
