CymitQuimica logo

CAS 88395-93-1

:

Butanoic acid, 4-chloro-, decyl ester

Description:
Butanoic acid, 4-chloro-, decyl ester, with the CAS number 88395-93-1, is an organic compound that belongs to the class of esters. It is characterized by the presence of a butanoic acid moiety, which is a four-carbon carboxylic acid, and a decyl group, which is a ten-carbon alkyl chain. The presence of a chlorine atom at the fourth carbon position of the butanoic acid structure introduces unique reactivity and properties, such as potential for nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is expected to be relatively hydrophobic due to the long decyl chain, which may influence its solubility in organic solvents and its behavior in biological systems. Additionally, the ester functional group suggests that it may undergo hydrolysis in the presence of water, leading to the release of butanoic acid and decanol. As with many esters, it may also exhibit low volatility and moderate stability under standard conditions.
Formula:C14H27ClO2
InChI:InChI=1S/C14H27ClO2/c1-2-3-4-5-6-7-8-9-13-17-14(16)11-10-12-15/h2-13H2,1H3
InChI key:UKINZMHKTPAMTL-UHFFFAOYSA-N
SMILES:CCCCCCCCCCOC(=O)CCCCl
Found 1 products.