CAS 883987-28-8

N4-Ethyl-2,4-pyridinediamine

Description:

N4-Ethyl-2,4-pyridinediamine, identified by its CAS number 883987-28-8, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two amino groups (-NH2) at the 2 and 4 positions of the pyridine ring, along with an ethyl group (-C2H5) attached to the nitrogen at the 4 position. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. N4-Ethyl-2,4-pyridinediamine may exhibit properties such as basicity due to the amino groups, and it could participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulations.

Formula: C₇H₁₁N₃

InChI: InChI=1S/C7H11N3/c1-2-9-6-3-4-10-7(8)5-6/h3-5H,2H2,1H3,(H3,8,9,10)

InChI key: InChIKey=QPIIVHTVJOPRLT-UHFFFAOYSA-N

SMILES: N(CC)C=1C=C(N)N=CC1

Synonyms:

• N4-Ethyl-2,4-pyridinediamine
• 2,4-Pyridinediamine, N4-ethyl-
• 2-Amino-4-ethylaminopyridine
• 2,4-Pyridinediamine N4-ethyl-