CAS 884-06-0
:1-(3,4-dimethoxyphenyl)butan-2-one
Description:
1-(3,4-Dimethoxyphenyl)butan-2-one, also known by its CAS number 884-06-0, is an organic compound characterized by its ketone functional group and a butan-2-one backbone. This compound features a phenyl ring substituted with two methoxy groups at the 3 and 4 positions, which significantly influence its chemical properties and reactivity. The presence of these methoxy groups enhances the compound's lipophilicity and can affect its biological activity. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. Its structure allows for potential applications in organic synthesis, pharmaceuticals, and as a flavoring or fragrance agent. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-4-10(13)7-9-5-6-11(14-2)12(8-9)15-3/h5-6,8H,4,7H2,1-3H3
SMILES:CCC(=O)Cc1ccc(c(c1)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(3,4-Dimethoxyphenyl)butan-2-one
CAS:Formula:C12H16O3Color and Shape:LiquidMolecular weight:208.25361-(3,4-Dimethoxyphenyl)-2-butanone
CAS:Controlled Product<p>Applications 1-(3,4-Dimethoxyphenyl)-2-butanone (cas# 884-06-0) is a compound useful in organic synthesis.<br></p>Formula:C12H16O3Color and Shape:NeatMolecular weight:208.25
