CymitQuimica logo

CAS 884-30-0

:

2,6-bis(trifluoromethyl)pyrimidin-4(1H)-one

Description:
2,6-Bis(trifluoromethyl)pyrimidin-4(1H)-one, with the CAS number 884-30-0, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is substituted at the 2 and 6 positions with trifluoromethyl groups. This compound exhibits notable properties due to the presence of the highly electronegative fluorine atoms, which enhance its lipophilicity and influence its reactivity. The carbonyl group at the 4-position contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The trifluoromethyl groups can impart unique electronic properties, making the compound of interest in medicinal chemistry for modifying biological activity. Additionally, 2,6-bis(trifluoromethyl)pyrimidin-4(1H)-one is typically stable under standard conditions but may undergo reactions typical of pyrimidine derivatives, such as nucleophilic substitutions or condensation reactions. Its applications may extend to materials science and as a reagent in various chemical transformations.
Formula:C6H2F6N2O
InChI:InChI=1/C6H2F6N2O/c7-5(8,9)2-1-3(15)14-4(13-2)6(10,11)12/h1H,(H,13,14,15)
SMILES:c1c(C(F)(F)F)nc(C(F)(F)F)nc1O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.