CAS 884-34-4
:2-(phenylsulfanyl)butanedioic acid
Description:
2-(Phenylsulfanyl)butanedioic acid, also known by its CAS number 884-34-4, is an organic compound characterized by the presence of a butanedioic acid backbone with a phenylsulfanyl group attached to the second carbon. This compound features two carboxylic acid functional groups (-COOH), which contribute to its acidity and reactivity. The phenylsulfanyl group introduces a sulfur atom bonded to a phenyl ring, enhancing the compound's potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of both the carboxylic acid and the phenylsulfanyl moieties allows for diverse applications in organic synthesis and medicinal chemistry. Additionally, the compound's structure may influence its solubility, stability, and interaction with biological systems. As with many organic acids, it may exhibit properties such as being a potential ligand in coordination chemistry or serving as a precursor in the synthesis of more complex molecules. Overall, 2-(phenylsulfanyl)butanedioic acid is a versatile compound with significant implications in chemical research and applications.
Formula:C10H10O4S
InChI:InChI=1/C10H10O4S/c11-9(12)6-8(10(13)14)15-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
