CAS 884-36-6
:Cyclododecanecarboxylic acid
Description:
Cyclododecanecarboxylic acid is a cyclic carboxylic acid characterized by a twelve-membered carbon ring structure with a carboxylic acid functional group. Its molecular formula is C12H22O2, and it features a unique combination of properties due to its cyclic nature. This compound typically appears as a white solid or crystalline substance at room temperature. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic characteristics. Cyclododecanecarboxylic acid is known for its potential applications in the synthesis of various chemical compounds, including surfactants and polymers. Additionally, it can serve as a building block in organic synthesis and may exhibit interesting biological properties. The compound's melting and boiling points are influenced by its molecular structure, and it may undergo typical reactions associated with carboxylic acids, such as esterification and acid-base reactions. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse effects.
Formula:C13H24O2
InChI:InChI=1S/C13H24O2/c14-13(15)12-10-8-6-4-2-1-3-5-7-9-11-12/h12H,1-11H2,(H,14,15)
InChI key:InChIKey=JWIPDQOXAJMVHL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCCCCCCCCCC1
Synonyms:- Cyclododecanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
