CymitQuimica logo

CAS 884-75-3

:

Phosphinic amide, P,P-bis(1-aziridinyl)-N-(5-chloro-2-pyrimidinyl)-

Description:
Phosphinic amide, P,P-bis(1-aziridinyl)-N-(5-chloro-2-pyrimidinyl)-, identified by CAS number 884-75-3, is a chemical compound characterized by its unique structural features, which include a phosphinic group and aziridine rings. This compound typically exhibits properties associated with phosphinic amides, such as potential reactivity in nucleophilic substitution reactions due to the presence of the phosphinic moiety. The aziridine rings contribute to its cyclic structure, which may influence its stability and reactivity. The presence of the 5-chloro-2-pyrimidinyl group suggests potential biological activity, as pyrimidine derivatives are often explored for their pharmacological properties. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be affected by environmental conditions such as pH and temperature. Overall, this compound's unique combination of functional groups makes it of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C8H11ClN5OP
InChI:InChI=1S/C8H11ClN5OP/c9-7-5-10-8(11-6-7)12-16(15,13-1-2-13)14-3-4-14/h5-6H,1-4H2,(H,10,11,12,15)
InChI key:InChIKey=GAGAPGPDTJRRNE-UHFFFAOYSA-N
SMILES:P(NC=1N=CC(Cl)=CN1)(=O)(N2CC2)N3CC3
Synonyms:
  • Phosphinic amide, P,P-bis(1-aziridinyl)-N-(5-chloro-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.