CAS 88404-01-7
:3-(4-aminopyridin-3-yl)-1,1-dimethylurea
Description:
3-(4-Aminopyridin-3-yl)-1,1-dimethylurea, identified by its CAS number 88404-01-7, is an organic compound characterized by its urea functional group and a pyridine ring. This substance typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is indicative of its ability to form hydrogen bonds due to the presence of amino and urea groups. The compound's structure includes a dimethylurea moiety, which contributes to its stability and potential biological activity. It is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aminopyridine group that may interact with biological targets. Additionally, the compound may exhibit properties such as moderate to high melting points and specific reactivity patterns typical of urea derivatives. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H12N4O
InChI:InChI=1/C8H12N4O/c1-12(2)8(13)11-7-5-10-4-3-6(7)9/h3-5H,1-2H3,(H2,9,10)(H,11,13)
Synonyms:- Urea, N'-(4-amino-3-pyridinyl)-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LF 14
CAS:<p>LF 14 affects mammalian non-myelinated nerve fibers.</p>Formula:C8H12N4OColor and Shape:SolidMolecular weight:180.21
