CymitQuimica logo

CAS 88404-44-8

:

N-(3-chlorophenyl)quinazolin-4-amine

Description:
N-(3-chlorophenyl)quinazolin-4-amine is a chemical compound characterized by its quinazoline core, which is a bicyclic structure containing both benzene and pyrimidine rings. The presence of a 3-chlorophenyl group at the nitrogen position enhances its biological activity and solubility properties. This compound typically exhibits properties such as moderate to high melting points and solubility in organic solvents, which can vary based on the specific formulation and purity. It is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit anti-cancer or anti-inflammatory activities. The chlorine substituent can influence the compound's reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions are essential, as it may pose risks if ingested or improperly handled. Overall, N-(3-chlorophenyl)quinazolin-4-amine represents a significant interest in drug development and chemical research due to its structural features and potential therapeutic applications.
Formula:C14H10ClN3
InChI:InChI=1/C14H10ClN3/c15-10-4-3-5-11(8-10)18-14-12-6-1-2-7-13(12)16-9-17-14/h1-9H,(H,16,17,18)
Synonyms:
  • 4-Quinazolinamine, N-(3-chlorophenyl)-
  • N-(3-Chlorophenyl)quinazolin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.