CAS 88404-45-9
:Quinazoline, 2,6,8-trichloro-4-(1-piperidinyl)-
Description:
Quinazoline, 2,6,8-trichloro-4-(1-piperidinyl)-, identified by its CAS number 88404-45-9, is a synthetic organic compound belonging to the quinazoline class of heterocyclic compounds. This substance features a quinazoline core, which is a bicyclic structure composed of a benzene ring fused to a pyrimidine ring. The presence of three chlorine atoms at the 2, 6, and 8 positions contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The 4-(1-piperidinyl) substituent enhances its pharmacological profile, as piperidine is known for its role in various biological activities and interactions with neurotransmitter systems. Quinazoline derivatives are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The compound's characteristics, such as solubility, stability, and reactivity, can be influenced by its chlorinated structure and piperidine moiety, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C13H12Cl3N3
InChI:InChI=1S/C13H12Cl3N3/c14-8-6-9-11(10(15)7-8)17-13(16)18-12(9)19-4-2-1-3-5-19/h6-7H,1-5H2
InChI key:InChIKey=LOGDETBMDDPXMF-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(=NC(Cl)=N2)N3CCCCC3)C=C(Cl)C1
Synonyms:- IPO 4452
- 2,6,8-Trichloro-4-piperidin-1-ylquinazoline
- Quinazoline, 2,6,8-trichloro-4-(1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
