CAS 884048-54-8

(1S,2R)-2-Hydroxycyclohexaneacetic acid

Description:

(1S,2R)-2-Hydroxycyclohexaneacetic acid, with the CAS number 884048-54-8, is an organic compound characterized by its cyclohexane ring structure and a hydroxyl group attached to the second carbon of the cyclohexane moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The stereochemistry indicated by the (1S,2R) notation suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions. Typically, compounds like this may exhibit solubility in polar solvents due to the presence of hydroxyl and carboxylic acid groups, making them suitable for various applications in pharmaceuticals or as intermediates in organic synthesis. The presence of the cyclohexane ring can also impart unique conformational properties, affecting the compound's overall stability and reactivity. Overall, (1S,2R)-2-Hydroxycyclohexaneacetic acid is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential biological implications.

Formula: C₈H₁₄O₃

InChI: InChI=1S/C8H14O3/c9-7-4-2-1-3-6(7)5-8(10)11/h6-7,9H,1-5H2,(H,10,11)/t6-,7+/m0/s1

InChI key: InChIKey=MRYQHECIEBLERJ-NKWVEPMBSA-N

SMILES: C(C(O)=O)[C@H]1[C@H](O)CCCC1

Synonyms:

• (1S,2R)-2-Hydroxycyclohexaneacetic acid
• Cyclohexaneacetic acid, 2-hydroxy-, (1S,2R)-

2-[(1S,2R)-2-Hydroxycyclohexyl]acetic acid

CAS: 884048-54-8

Versatile small molecule scaffold

Formula: C₈H₁₄O₃

Purity: Min. 95%

Molecular weight: 158.19 g/mol

Ref: 3D-JKB04854