CymitQuimica logo

CAS 884049-52-9

:

Spiro[piperidine-4,3'-[3H]pyrrolo[2,3-b]pyridin]-2'(1'H)-one

Description:
Spiro[piperidine-4,3'-[3H]pyrrolo[2,3-b]pyridin]-2'(1'H)-one, with the CAS number 884049-52-9, is a heterocyclic compound characterized by its unique spirocyclic structure that incorporates both piperidine and pyrrolo-pyridine moieties. This compound typically exhibits a complex three-dimensional arrangement, which can influence its biological activity and chemical reactivity. The presence of nitrogen atoms in its structure suggests potential basicity and the ability to participate in hydrogen bonding, making it of interest in medicinal chemistry. Additionally, the spiro configuration can impart distinctive steric and electronic properties, potentially affecting its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in treating neurological disorders or as novel therapeutic agents. The stability, solubility, and reactivity of this compound can vary based on its specific substituents and the conditions under which it is studied. Overall, spiro compounds like this one are valuable in the development of new drugs and materials due to their diverse chemical behavior.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c15-10-11(3-6-12-7-4-11)8-2-1-5-13-9(8)14-10/h1-2,5,12H,3-4,6-7H2,(H,13,14,15)
InChI key:JFFUXCQOFURYMG-UHFFFAOYSA-N
SMILES:C1CNCCC12C3=C(NC2=O)N=CC=C3
Synonyms:
  • spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one
  • Spiro[piperidine-4,3'-pyrrolo[2,3-b]pyridin]-2'(1'H)-one
  • Spiro[piperidine-4,3'-[3H]pyrrolo[2,3-b]pyridin]-2'(1'H)-one
Found 2 products.