CAS 88411-81-8
:4-(methylsulfanyl)butanamide
Description:
4-(Methylsulfanyl)butanamide, with the CAS number 88411-81-8, is an organic compound characterized by the presence of a butanamide backbone substituted with a methylsulfanyl group. This compound features a four-carbon chain (butane) with an amide functional group (-C(=O)NH2) at one end, and a methylsulfanyl group (-S-CH3) attached to the fourth carbon. The presence of the methylsulfanyl group imparts unique properties, such as potential reactivity in nucleophilic substitution reactions and the ability to participate in various chemical transformations. The compound is likely to exhibit moderate solubility in polar solvents due to the amide functionality, while the sulfur atom may influence its overall polarity and reactivity. Additionally, the presence of both sulfur and nitrogen in its structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can enhance biological activity or interaction with biological systems. Overall, 4-(methylsulfanyl)butanamide is a versatile compound with interesting chemical properties stemming from its unique structural features.
Formula:C5H11NOS
InChI:InChI=1/C5H11NOS/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H2,6,7)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(Methylsulfanyl)butanamide
CAS:4-(Methylsulfanyl)butanamide is a chiral compound that is derived from the amino acids valine, threonine, and methionine. It has been shown to inhibit the growth of Rhodococcus erythropolis in culture by blocking nitrile synthesis and hydrolysis. The mechanism of action for 4-(methylsulfanyl)butanamide is not clear. However, it has been shown to contain sequences related to those found in other amino acid sequences that are known to be involved in cell division.Formula:C5H11NOSPurity:Min. 95%Molecular weight:133.21 g/mol
