CAS 88419-02-7
:3-[2-(4-Bromophenyl)-2-oxoethyl]-2,4-thiazolidinedione
Description:
3-[2-(4-Bromophenyl)-2-oxoethyl]-2,4-thiazolidinedione, with the CAS number 88419-02-7, is a synthetic organic compound that belongs to the thiazolidinedione class of molecules. This compound features a thiazolidinedione core, characterized by a five-membered ring containing both sulfur and nitrogen atoms, which is known for its biological activity, particularly in the context of diabetes management. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The oxoethyl substituent contributes to its reactivity and potential pharmacological properties. Thiazolidinediones are often studied for their role as agonists of peroxisome proliferator-activated receptors (PPARs), which are involved in glucose and lipid metabolism. The compound may exhibit various biological activities, including anti-inflammatory and antioxidant effects, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, melting point, and stability, would depend on the molecular structure and the conditions under which it is studied.
Formula:C11H8BrNO3S
InChI:InChI=1S/C11H8BrNO3S/c12-8-3-1-7(2-4-8)9(14)5-13-10(15)6-17-11(13)16/h1-4H,5-6H2
InChI key:InChIKey=JGERYDQMWNFXFR-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=C(Br)C=C1)N2C(=O)CSC2=O
Synonyms:- 2,4-Thiazolidinedione, 3-[2-(4-bromophenyl)-2-oxoethyl]-
- 3-[2-(4-Bromophenyl)-2-oxoethyl]-2,4-thiazolidinedione
- 3-[2-(4-bromophenyl)-2-oxoethyl]-1,3-thiazolane-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.