CAS 88419-04-9
:3-[2-(4-Nitrophenyl)-2-oxoethyl]-2,4-thiazolidinedione
Description:
3-[2-(4-Nitrophenyl)-2-oxoethyl]-2,4-thiazolidinedione, with the CAS number 88419-04-9, is a chemical compound that belongs to the class of thiazolidinediones, which are known for their role in pharmacology, particularly in the treatment of diabetes. This compound features a thiazolidinedione core, characterized by a five-membered ring containing sulfur and nitrogen atoms, which is fused with a phenyl group substituted with a nitro group. The presence of the nitrophenyl moiety contributes to its potential biological activity, possibly influencing its interaction with various biological targets. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the presence of electrophilic sites, making it of interest for further chemical modifications or as a lead compound in drug development. Additionally, the thiazolidinedione framework is associated with anti-inflammatory and insulin-sensitizing properties, which may be relevant in therapeutic contexts.
Formula:C11H8N2O5S
InChI:InChI=1S/C11H8N2O5S/c14-9(5-12-10(15)6-19-11(12)16)7-1-3-8(4-2-7)13(17)18/h1-4H,5-6H2
InChI key:InChIKey=QLRJSLVDLORWMT-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=C(N(=O)=O)C=C1)N2C(=O)CSC2=O
Synonyms:- 2,4-Thiazolidinedione, 3-[2-(4-nitrophenyl)-2-oxoethyl]-
- 3-[2-(4-Nitrophenyl)-2-oxoethyl]-2,4-thiazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Thiazolidinedione, 3-[2-(4-nitrophenyl)-2-oxoethyl]-
CAS:Formula:C11H8N2O5SMolecular weight:280.2566
