CAS 88422-19-9

(S)-(-)-1-(4-nitrophenyl)-2-pyrrolidine-methanol,

Description:

(S)-(-)-1-(4-nitrophenyl)-2-pyrrolidine-methanol is a chiral compound characterized by its specific stereochemistry, indicated by the (S) configuration. This compound features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a 4-nitrophenyl group, contributing to its aromatic properties and potential reactivity. The presence of the hydroxymethyl group (-CH2OH) suggests that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The nitro group (-NO2) on the phenyl ring is an electron-withdrawing group, which can affect the compound's electronic properties and reactivity, making it potentially useful in various chemical reactions or as a building block in organic synthesis. Additionally, the chirality of the compound may impart specific biological activities, making it of interest in pharmaceutical applications. Overall, this compound's unique structural features and functional groups contribute to its potential utility in research and industry.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1/C11H14N2O3/c14-8-11-2-1-7-12(11)9-3-5-10(6-4-9)13(15)16/h3-6,11,14H,1-2,7-8H2/t11-/m0/s1

SMILES: C1C[C@@H](CO)N(C1)c1ccc(cc1)N(=O)=O

Synonyms:

• (S)-()-1-(4-Nitrophenyl)-2-pyrrolidinemethanol
• [(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methanol