CAS 88425-47-2: 1-(Phenylsulfonyl)proline

Description:1-(Phenylsulfonyl)proline, with the CAS number 88425-47-2, is an organic compound characterized by the presence of a proline amino acid structure modified with a phenylsulfonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and methanol, while being less soluble in non-polar solvents. The sulfonyl group contributes to its reactivity, making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The proline moiety imparts unique stereochemical properties, which can influence biological activity and interactions with enzymes or receptors. Additionally, 1-(Phenylsulfonyl)proline may exhibit potential as a chiral auxiliary in asymmetric synthesis, enhancing the production of enantiomerically pure compounds. Its stability under standard laboratory conditions allows for its use in various applications, including medicinal chemistry and organic synthesis. As with many sulfonyl-containing compounds, it is important to handle it with care, considering potential toxicity and environmental impact.

Formula:C₁₁H₁₃NO₄S

InChI:InChI=1S/C11H13NO4S/c13-11(14)10-7-4-8-12(10)17(15,16)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,13,14)

InChI key:InChIKey=JUSWZYFYLXTMLJ-UHFFFAOYSA-N

SMILES:O=C(O)C1N(CCC1)S(=O)(=O)C=2C=CC=CC2