CAS 884325-48-8

8-(Chloromethyl)-4H-1,3-benzodioxin-6-carboxylic acid

Description:

8-(Chloromethyl)-4H-1,3-benzodioxin-6-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety and a carboxylic acid functional group. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in organic synthesis. This compound typically exhibits moderate solubility in organic solvents, while its carboxylic acid group can impart some degree of polarity, allowing for interactions with polar solvents. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the chloromethyl group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, handling and usage should be approached with caution due to the presence of chlorine, which can pose environmental and health risks. As with many synthetic compounds, proper safety protocols should be followed during its synthesis and application.

Formula: C₁₀H₉ClO₄

InChI: InChI=1S/C10H9ClO4/c11-3-7-1-6(10(12)13)2-8-4-14-5-15-9(7)8/h1-2H,3-5H2,(H,12,13)

InChI key: InChIKey=LCWRWKXQOUXGMA-UHFFFAOYSA-N

SMILES: C(Cl)C1=C2C(=CC(C(O)=O)=C1)COCO2

Synonyms:

• 8-(Chloromethyl)-4H-1,3-benzodioxin-6-carboxylic acid
• 4H-1,3-Benzodioxin-6-carboxylic acid, 8-(chloromethyl)-