CAS 884330-10-3
:2,6′-Bi-1H-benzimidazole, 1′-hydroxy-1,4′-dimethyl-2′-propyl-
Description:
2,6′-Bi-1H-benzimidazole, 1′-hydroxy-1,4′-dimethyl-2′-propyl- is a chemical compound characterized by its complex structure, which includes two benzimidazole units linked together. This compound features a hydroxyl group and two methyl groups, as well as a propyl substituent, contributing to its unique chemical properties. The presence of the hydroxyl group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The methyl and propyl groups can affect the compound's steric hindrance and lipophilicity, potentially impacting its biological activity and interactions with other molecules. As a benzimidazole derivative, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 884330-10-3, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and materials science. Overall, this compound's structural features suggest a range of potential applications, particularly in drug development and chemical synthesis.
Formula:C19H20N4O
InChI:InChI=1S/C19H20N4O/c1-4-7-17-21-18-12(2)10-13(11-16(18)23(17)24)19-20-14-8-5-6-9-15(14)22(19)3/h5-6,8-11,24H,4,7H2,1-3H3
InChI key:InChIKey=UAGMAEHNCFRLLO-UHFFFAOYSA-N
SMILES:ON1C=2C(N=C1CCC)=C(C)C=C(C2)C=3N(C)C=4C(N3)=CC=CC4
Synonyms:- 2-n-Propyl-4-methyl-6-(1-methylbenzimidazole-2-yl)-1-hydroxybenzimidazole
- 2,6′-Bi-1H-benzimidazole, 1′-hydroxy-1,4′-dimethyl-2′-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
