CAS 88434-68-8

2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid

Description:

2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with two methyl groups and a nitrophenyl group. This compound features two carboxylic acid functional groups, contributing to its acidity and potential reactivity. The presence of the nitro group on the phenyl ring enhances its electron-withdrawing properties, which can influence the compound's reactivity and interactions in various chemical environments. Typically, such compounds may exhibit properties like solubility in polar solvents, moderate stability under standard conditions, and potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of substituents can also affect its biological activity, making it of interest in medicinal chemistry. Overall, 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid is a versatile compound with significant implications in various fields of chemistry.

Formula: C₁₅H₁₂N₂O₆

InChI: InChI=1S/C15H12N2O6/c1-7-11(14(18)19)13(12(15(20)21)8(2)16-7)9-4-3-5-10(6-9)17(22)23/h3-6H,1-2H3,(H,18,19)(H,20,21)

InChI key: InChIKey=QLKWNZOBTJKSCW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=C(C(O)=O)C(C)=NC1C)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• 2,6-Dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid
• 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid
• 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(3-nitrophenyl)-

Nicardipine Impurity 45

CAS: 88434-68-8

Formula: C₁₅H₁₂N₂O₆

Molecular weight: 316.27

Ref: 4Z-N-4869