CAS 88440-55-5

{[N-(ammonioacetyl)-L-cysteinyl]amino}acetate

Description:

The chemical substance known as {[N-(ammonioacetyl)-L-cysteinyl]amino}acetate, with the CAS number 88440-55-5, is a derivative of the amino acid cysteine, which is notable for its thiol (-SH) group that plays a crucial role in protein structure and function. This compound features an ammonioacetyl group, indicating the presence of an acetyl group attached to an amino group, which contributes to its solubility and reactivity. The presence of both amino and carboxylate functional groups suggests that it can participate in various biochemical reactions, including those involving peptide bond formation. Its structure allows it to act as a potential chelating agent, binding metal ions, and it may also exhibit antioxidant properties due to the thiol group. This compound is of interest in biochemical research and potential therapeutic applications, particularly in the fields of drug design and protein engineering. Its stability, solubility, and reactivity make it a valuable subject for further study in medicinal chemistry and biochemistry.

Formula: C₇H₁₃N₃O₄S

InChI: InChI=1/C7H13N3O4S/c8-1-5(11)10-4(3-15)7(14)9-2-6(12)13/h4,15H,1-3,8H2,(H,9,14)(H,10,11)(H,12,13)/t4-/m0/s1

SMILES: C(C(=N[C@@H](CS)C(=NCC(=O)O)O)O)N

Synonyms:

• glycine, glycyl-L-cysteinyl-
• Glycyl-L-cysteinylglycine

H-Gly-Cys-Gly-OH

CAS: 88440-55-5

H-Gly-Cys-Gly-OH is an amino acid sequence that has been evaluated for its interactions with other amino acids and proteins. It is a tripeptide heterocycle and can be found in the tissues of many organisms, including humans. H-Gly-Cys-Gly-OH can be found in bovine serum and has been shown to have reversed phase high performance liquid chromatography activity. This molecule also interacts with reversed phase high performance liquid chromatography, ion exchange, and tripeptides.

Formula: C₇H₁₃N₃O₄S

Purity: Min. 95%

Molecular weight: 235.26 g/mol

Ref: 3D-FG108463

H-Gly-Cys-Gly-OH

CAS: 88440-55-5

Bachem ID: 4019162.

Formula: C₇H₁₃N₃O₄S

Purity: 99.5%

Color and Shape: White Powder

Molecular weight: 235.26

Ref: 01-4019162