CAS 88441-16-1

2-[2-(4-Chloro-2,5-dimethoxyphenyl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[2-(4-Chloro-2,5-dimethoxyphenyl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 88441-16-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole core and a substituted phenyl group. This compound features a chloro substituent and two methoxy groups on the phenyl ring, contributing to its unique chemical properties. It is typically classified as a derivative of isoindole, which is known for its applications in medicinal chemistry and potential biological activity. The presence of the chloro and methoxy groups can influence the compound's reactivity, solubility, and interaction with biological targets. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its potential therapeutic applications or as a chemical probe in biological research. Safety and handling precautions should be observed due to the presence of halogenated and potentially reactive functional groups.

Formula: C₁₈H₁₆ClNO₄

InChI: InChI=1S/C18H16ClNO4/c1-23-15-10-14(19)16(24-2)9-11(15)7-8-20-17(21)12-5-3-4-6-13(12)18(20)22/h3-6,9-10H,7-8H2,1-2H3

InChI key: InChIKey=CTEUVMABFCVHRY-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CCC3=C(OC)C=C(Cl)C(OC)=C3)=CC=CC2

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-[2-(4-chloro-2,5-dimethoxyphenyl)ethyl]-
• 2-[2-(4-Chloro-2,5-dimethoxyphenyl)ethyl]-1H-isoindole-1,3(2H)-dione

1H-Isoindole-1,3(2H)-dione, 2-[2-(4-chloro-2,5-dimethoxyphenyl)ethyl]-

CAS: 88441-16-1

Formula: C₁₈H₁₆ClNO₄

Molecular weight: 345.7769

Ref: IN-DA004ENA