CAS 88444-81-9
:3',5'-Bis(trifluoromethyl)phenyl acetylene
Description:
3',5'-Bis(trifluoromethyl)phenyl acetylene, with the CAS number 88444-81-9, is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with two trifluoromethyl groups at the 3' and 5' positions, along with an acetylene functional group. This compound is typically a colorless to pale yellow solid and is known for its high thermal stability and low volatility. The presence of trifluoromethyl groups enhances its electron-withdrawing properties, which can significantly influence its reactivity and interactions with other chemical species. It is often utilized in organic synthesis and materials science, particularly in the development of advanced polymers and pharmaceuticals. Additionally, due to its fluorinated nature, it may exhibit unique solubility and surface activity characteristics, making it of interest in various applications, including agrochemicals and specialty chemicals. Safety precautions should be observed when handling this compound, as fluorinated compounds can pose health and environmental risks.
Formula:C10H4F6
InChI:InChI=1/C10H4F6/c1-2-6-3-7(9(11,12)13)5-8(4-6)10(14,15)16/h1,3-5H
SMILES:C#Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
Synonyms:- 1-Ethynyl-3,5-bis(trifluoromethyl)benzene
- Benzene, 1-ethynyl-3,5-bis(trifluoromethyl)-
- 3,5-Bis(trifluoromethyl)phenylacetylene
- 3,5-Bis-Trifluoromethylphenyl Acetylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Ethynyl-3,5-bis(trifluoromethyl)benzene
CAS:Formula:C10H4F6Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:238.133',5'-Bis(trifluoromethyl)phenylacetylene
CAS:Formula:C10H4F6Purity:96%Color and Shape:LiquidMolecular weight:238.1292Ref: IN-DA003EBO
1g25.00€5g60.00€10g91.00€25g171.00€50g222.00€100g565.00€250gTo inquire500gTo inquire250mg24.00€3,5-Bis(trifluoromethyl)phenylacetylene
CAS:<p>3,5-Bis(trifluoromethyl)phenylacetylene</p>Formula:C10H4F6Purity:99%Color and Shape: clear. orange liquidMolecular weight:238.13g/mol3′,5′-Bis-trifluoromethylphenyl acetylene
CAS:Formula:C10H4F6Purity:96%Color and Shape:LiquidMolecular weight:238.1323',5'-Bis(trifluoromethyl)phenyl acetylene
CAS:<p>3',5'-Bis(trifluoromethyl)phenyl acetylene is a fluorinated derivative of acetylene. It is a luminescent molecule that can be used as a probe for the study of protein-ligand binding. The crystal x-ray diffraction and photophysical properties of this compound have been investigated. 3',5'-Bis(trifluoromethyl)phenyl acetylene has shown bright emission in the visible region with high efficiencies, making it an attractive candidate for use in light-emitting diodes (LEDs). This functional group also has trifunctional properties, which means it can undergo three chemical reactions at the same time.</p>Formula:C10H4F6Purity:Min. 95%Molecular weight:238.13 g/mol




