CymitQuimica logo

CAS 88449-50-7

:

Benzeneacetic acid, 3-methoxy-4-(1-methylethoxy)-

Description:
Benzeneacetic acid, 3-methoxy-4-(1-methylethoxy)-, also known by its CAS number 88449-50-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a methoxy group and an ethoxy group, which contribute to its chemical reactivity and solubility properties. This compound typically exhibits moderate polarity due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, where such derivatives may serve as intermediates or active ingredients. The presence of the methoxy and ethoxy groups can influence its biological activity and solubility in various solvents. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, benzeneacetic acid derivatives are of interest in various fields, including medicinal chemistry and materials science, due to their diverse chemical properties and potential applications.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-8(2)16-10-5-4-9(7-12(13)14)6-11(10)15-3/h4-6,8H,7H2,1-3H3,(H,13,14)
InChI key:TWZIQDJXVGSPSD-UHFFFAOYSA-N
SMILES:CC(C)OC1=C(C=C(C=C1)CC(=O)O)OC
Found 3 products.