CAS 884494-37-5

2-bromo-3-fluoro-4-methyl-pyridine

Description:

2-Bromo-3-fluoro-4-methyl-pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the second position, a fluorine atom at the third position, and a methyl group at the fourth position. This compound is part of the pyridine family, which is known for its aromatic properties and basicity due to the nitrogen atom in the ring. The presence of halogen substituents (bromine and fluorine) can significantly influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The methyl group contributes to the compound's hydrophobic characteristics, while the halogens can enhance its electrophilic reactivity. Additionally, the compound's molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of substituents. Overall, 2-bromo-3-fluoro-4-methyl-pyridine is a versatile compound with significant implications in organic synthesis and medicinal applications.

Formula: C₆H₅BrFN

InChI: InChI=1/C6H5BrFN/c1-4-2-3-9-6(7)5(4)8/h2-3H,1H3

SMILES: Cc1ccnc(c1F)Br

Synonyms:

• 2-Bromo-3-Fluoro-4-Methylpyridine
• 2-Bromo-3-fluoro-4-picoline
• Pyridine, 2-Bromo-3-Fluoro-4-Methyl-

2-Bromo-3-fluoro-4-picoline

CAS: 884494-37-5

Formula: C₆H₅BrFN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 190.0130

Ref: IN-DA00GRJT

2-Bromo-3-fluoro-4-picoline

CAS: 884494-37-5

2-Bromo-3-fluoro-4-picoline

Purity: 98%

Molecular weight: 190.01g/mol

Ref: 54-PC201348

2-Bromo-3-fluoro-4-picoline

CAS: 884494-37-5

Formula: C₆H₅BrFN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 190.015

Ref: 10-F079775