CAS 884494-38-6

1-Bromo-3,5-difluoro-2-nitrobenzene

Description:

1-Bromo-3,5-difluoro-2-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 2-position, which is an electron-withdrawing group, enhancing the reactivity of the compound. The bromine atom at the 1-position and the difluoro substituents at the 3 and 5 positions contribute to its unique electronic properties and steric effects. This compound is typically a pale yellow solid at room temperature and is soluble in organic solvents. Its reactivity can be attributed to the presence of the nitro group, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens like bromine and fluorine can influence its physical properties, such as boiling and melting points, as well as its potential applications in pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₆H₂BrF₂NO₂

InChI: InChI=1/C6H2BrF2NO2/c7-4-1-3(8)2-5(9)6(4)10(11)12/h1-2H

SMILES: c1c(cc(c(c1Br)N(=O)=O)F)F

Synonyms:

• Benzene, 1-Bromo-3,5-Difluoro-2-Nitro-

2-Bromo-4,6-difluoronitrobenzene

CAS: 884494-38-6

Formula: C₆H₂BrF₂NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 237.9864

Ref: IN-DA004EMH

2-Bromo-4,6-difluoronitrobenzene

CAS: 884494-38-6

2-Bromo-4,6-difluoronitrobenzene

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: off-white to faint yellow crystalline powder

Molecular weight: 237.99g/mol

Ref: 54-PC48460

2-Bromo-4,6-difluoronitrobenzene

CAS: 884494-38-6

Formula: C₆H₂BrF₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.988

Ref: 10-F078079