CAS 884494-44-4
:2-Chloro-4-iodo-3-pyridinemethanol
Description:
2-Chloro-4-iodo-3-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of both chlorine and iodine substituents on the pyridine ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The hydroxymethyl group (-CH2OH) attached to the pyridine ring enhances its solubility in polar solvents and may influence its biological activity. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Its molecular structure allows for various chemical modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 2-Chloro-4-iodo-3-pyridinemethanol represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C6H5ClINO
InChI:InChI=1/C6H5ClINO/c7-6-4(3-10)5(8)1-2-9-6/h1-2,10H,3H2
SMILES:c1cnc(c(CO)c1I)Cl
Synonyms:- (2-Chloro-4-Iodopyridin-3-Yl)Methanol
- 3-Pyridinemethanol, 2-Chloro-4-Iodo-
- (2-Chloro-4-Iodo-3-Pyridyl)Methanol
- 2-Chloro-3-(hydroxymethyl)-4-iodopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-4-iodo-3-pyridinemethanol, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5ClINOPurity:97%Color and Shape:Off-white, Crystalline solidMolecular weight:269.47(2-Chloro-4-iodopyridin-3-yl)methanol
CAS:Formula:C6H5ClINOPurity:97%Color and Shape:SolidMolecular weight:269.4675(2-Chloro-4-iodopyridin-3-yl)methanol
CAS:(2-Chloro-4-iodopyridin-3-yl)methanolPurity:98%Molecular weight:269.47g/mol



